C23H28BFN2O2 — CID 176950560
CID 176950560 (PubChem CID 176950560) has the molecular formula C23H28BFN2O2 and a molecular weight of 394.30 g/mol.
| Compound Name | CID 176950560 |
|---|---|
| PubChem CID | 176950560 |
| Molecular Formula | C23H28BFN2O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | — |
| SMILES | [B]C1(O)c2ccc(F)cc2CCN1c1cc(C)c(NC(=O)CC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C23H28BFN2O2/c1-14-10-18(11-15(2)21(14)26-20(28)13-22(3,4)5)27-9-8-16-12-17(25)6-7-19(16)23(27,24)29/h6-7,10-12,29H,8-9,13H2,1-5H3,(H,26,28) |
| InChIKey | PZZUOPJMWVFIQC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|