C10H10F2N2O2S — CID 176950619
5,5-difluoro-11-methyl-4,6-dioxa-12-thia-2,10-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8,10-tetraene;ethane (PubChem CID 176950619) has the molecular formula C10H10F2N2O2S and a molecular weight of 260.26 g/mol. Its IUPAC name is 5,5-difluoro-11-methyl-4,6-dioxa-12-thia-2,10-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8,10-tetraene;ethane.
| Compound Name | 5,5-difluoro-11-methyl-4,6-dioxa-12-thia-2,10-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8,10-tetraene;ethane |
|---|---|
| PubChem CID | 176950619 |
| Molecular Formula | C10H10F2N2O2S |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 5,5-difluoro-11-methyl-4,6-dioxa-12-thia-2,10-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8,10-tetraene;ethane |
| SMILES | CC.Cc1nc2cc3c(nc2s1)OC(F)(F)O3 |
| InChI | InChI=1S/C8H4F2N2O2S.C2H6/c1-3-11-4-2-5-6(12-7(4)15-3)14-8(9,10)13-5;1-2/h2H,1H3;1-2H3 |
| InChIKey | PWQMYERCVBFKJO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |