C10H13F2N2O+ — CID 176950744
4-[(3S)-4,4-difluoropiperidin-3-yl]-1-hydroxypyridin-1-ium (PubChem CID 176950744) has the molecular formula C10H13F2N2O+ and a molecular weight of 215.22 g/mol. Its IUPAC name is 4-[(3S)-4,4-difluoropiperidin-3-yl]-1-hydroxypyridin-1-ium.
| Compound Name | 4-[(3S)-4,4-difluoropiperidin-3-yl]-1-hydroxypyridin-1-ium |
|---|---|
| PubChem CID | 176950744 |
| Molecular Formula | C10H13F2N2O+ |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 4-[(3S)-4,4-difluoropiperidin-3-yl]-1-hydroxypyridin-1-ium |
| SMILES | O[n+]1ccc([C@H]2CNCCC2(F)F)cc1 |
| InChI | InChI=1S/C10H13F2N2O/c11-10(12)3-4-13-7-9(10)8-1-5-14(15)6-2-8/h1-2,5-6,9,13,15H,3-4,7H2/q+1/t9-/m1/s1 |
| InChIKey | FDQXVAIHLMOBNS-SECBINFHSA-N |
| XLogP | 0.92 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|