C13H10ClF3N4O2 — CID 176950985
7-chloro-4-(8,8-difluoro-5-oxa-2-azabicyclo[5.1.0]octan-2-yl)-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 176950985) has the molecular formula C13H10ClF3N4O2 and a molecular weight of 346.70 g/mol. Its IUPAC name is 7-chloro-4-(8,8-difluoro-5-oxa-2-azabicyclo[5.1.0]octan-2-yl)-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 7-chloro-4-(8,8-difluoro-5-oxa-2-azabicyclo[5.1.0]octan-2-yl)-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 176950985 |
| Molecular Formula | C13H10ClF3N4O2 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 7-chloro-4-(8,8-difluoro-5-oxa-2-azabicyclo[5.1.0]octan-2-yl)-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(N2CCOCC3C2C3(F)F)c2cnc(Cl)c(F)c2[nH]1 |
| InChI | InChI=1S/C13H10ClF3N4O2/c14-10-7(15)8-5(3-18-10)11(20-12(22)19-8)21-1-2-23-4-6-9(21)13(6,16)17/h3,6,9H,1-2,4H2,(H,19,20,22) |
| InChIKey | OLSVZRIHCGAIRM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|