C19H27F3N4O4 — CID 176953603
(1S,2R,3R,4R,5S)-1-[(4-ethylpiperazin-1-yl)methyl]-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 176953603) has the molecular formula C19H27F3N4O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-1-[(4-ethylpiperazin-1-yl)methyl]-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-1-[(4-ethylpiperazin-1-yl)methyl]-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 176953603 |
| Molecular Formula | C19H27F3N4O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (1S,2R,3R,4R,5S)-1-[(4-ethylpiperazin-1-yl)methyl]-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | CCN1CCN(C[C@@]23CO[C@@H](O2)[C@H](Nc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]3O)CC1 |
| InChI | InChI=1S/C19H27F3N4O4/c1-2-25-6-8-26(9-7-25)10-18-11-29-17(30-18)14(15(27)16(18)28)24-13-5-3-4-12(23-13)19(20,21)22/h3-5,14-17,27-28H,2,6-11H2,1H3,(H,23,24)/t14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | IUTUDAUUGNBMIN-DZVNLGKHSA-N |
| XLogP | 0.37 |
| TPSA | 90.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |