C36H56F3N3O10 — CID 176954448
4-[(Z)-5-amino-6-[amino-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4,6-trifluorophenyl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]hex-5-enoxy]phenol (PubChem CID 176954448) has the molecular formula C36H56F3N3O10 and a molecular weight of 747.85 g/mol. Its IUPAC name is 4-[(Z)-5-amino-6-[amino-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4,6-trifluorophenyl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]hex-5-enoxy]phenol.
| Compound Name | 4-[(Z)-5-amino-6-[amino-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4,6-trifluorophenyl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]hex-5-enoxy]phenol |
|---|---|
| PubChem CID | 176954448 |
| Molecular Formula | C36H56F3N3O10 |
| Molecular Weight | 747.85 g/mol |
| Exact Mass | 747.39 |
| IUPAC Name | 4-[(Z)-5-amino-6-[amino-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4,6-trifluorophenyl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]hex-5-enoxy]phenol |
| SMILES | N/C(=C\N(N)CCOCCOCCOCCOCCOCCOCCOCCOCCc1c(F)cc(F)cc1F)CCCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C36H56F3N3O10/c37-30-27-35(38)34(36(39)28-30)8-11-44-13-15-46-17-19-48-21-23-50-25-26-51-24-22-49-20-18-47-16-14-45-12-9-42(41)29-31(40)3-1-2-10-52-33-6-4-32(43)5-7-33/h4-7,27-29,43H,1-3,8-26,40-41H2/b31-29- |
| InChIKey | MSJYIBHKSKXQDF-YCNYHXFESA-N |
| XLogP | 3.71 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|