C23H32N2O4 — CID 176960602
tert-butyl N-methyl-N-[(5Z)-3-methyl-4-methylidene-7-(phenoxycarbonylamino)octa-5,7-dienyl]carbamate (PubChem CID 176960602) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(5Z)-3-methyl-4-methylidene-7-(phenoxycarbonylamino)octa-5,7-dienyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(5Z)-3-methyl-4-methylidene-7-(phenoxycarbonylamino)octa-5,7-dienyl]carbamate |
|---|---|
| PubChem CID | 176960602 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | tert-butyl N-methyl-N-[(5Z)-3-methyl-4-methylidene-7-(phenoxycarbonylamino)octa-5,7-dienyl]carbamate |
| SMILES | C=C(/C=C\C(=C)C(C)CCN(C)C(=O)OC(C)(C)C)NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C23H32N2O4/c1-17(18(2)15-16-25(7)22(27)29-23(4,5)6)13-14-19(3)24-21(26)28-20-11-9-8-10-12-20/h8-14,18H,1,3,15-16H2,2,4-7H3,(H,24,26)/b14-13- |
| InChIKey | DTNZZPSSPFRHHP-YPKPFQOOSA-N |
| XLogP | 5.29 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|