C17H26N2O4S — CID 176961100
tert-butyl N-[4-[(5-formyl-2-methyl-1,3-thiazol-4-yl)oxymethyl]cyclohexyl]carbamate (PubChem CID 176961100) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-formyl-2-methyl-1,3-thiazol-4-yl)oxymethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-formyl-2-methyl-1,3-thiazol-4-yl)oxymethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 176961100 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | tert-butyl N-[4-[(5-formyl-2-methyl-1,3-thiazol-4-yl)oxymethyl]cyclohexyl]carbamate |
| SMILES | Cc1nc(OCC2CCC(NC(=O)OC(C)(C)C)CC2)c(C=O)s1 |
| InChI | InChI=1S/C17H26N2O4S/c1-11-18-15(14(9-20)24-11)22-10-12-5-7-13(8-6-12)19-16(21)23-17(2,3)4/h9,12-13H,5-8,10H2,1-4H3,(H,19,21) |
| InChIKey | WPIQMSQLHFWOPH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|