C12H22F2 — CID 176963028
(E)-6-ethyl-4,4-difluoro-8-methylnon-2-ene (PubChem CID 176963028) has the molecular formula C12H22F2 and a molecular weight of 204.30 g/mol. Its IUPAC name is (E)-6-ethyl-4,4-difluoro-8-methylnon-2-ene.
| Compound Name | (E)-6-ethyl-4,4-difluoro-8-methylnon-2-ene |
|---|---|
| PubChem CID | 176963028 |
| Molecular Formula | C12H22F2 |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | (E)-6-ethyl-4,4-difluoro-8-methylnon-2-ene |
| SMILES | C/C=C/C(F)(F)CC(CC)CC(C)C |
| InChI | InChI=1S/C12H22F2/c1-5-7-12(13,14)9-11(6-2)8-10(3)4/h5,7,10-11H,6,8-9H2,1-4H3/b7-5+ |
| InChIKey | DSSKVYUTXLWPFM-FNORWQNLSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|