C28H25FN5P — CID 176968124
1-[2-ethyl-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-phosphanylpyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile (PubChem CID 176968124) has the molecular formula C28H25FN5P and a molecular weight of 481.52 g/mol. Its IUPAC name is 1-[2-ethyl-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-phosphanylpyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile.
| Compound Name | 1-[2-ethyl-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-phosphanylpyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile |
|---|---|
| PubChem CID | 176968124 |
| Molecular Formula | C28H25FN5P |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1-[2-ethyl-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-phosphanylpyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile |
| SMILES | C#Cc1c(F)ccc2cccc(-c3ncc4c(N5CCCC(C#N)CC5)nc(CC)nc4c3P)c12 |
| InChI | InChI=1S/C28H25FN5P/c1-3-19-22(29)11-10-18-8-5-9-20(24(18)19)25-27(35)26-21(16-31-25)28(33-23(4-2)32-26)34-13-6-7-17(15-30)12-14-34/h1,5,8-11,16-17H,4,6-7,12-14,35H2,2H3 |
| InChIKey | DKINHWNBCWJHTK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|