About 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane
4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane (PubChem CID 176971137) has the molecular formula C15H29F3O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane.
Molecular Properties
| Compound Name | 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane |
| PubChem CID | 176971137 |
| Molecular Formula | C15H29F3O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane |
| SMILES | CCC(F)(F)F.CCCC(CCC=O)COC(C)(C)C |
| InChI | InChI=1S/C12H24O2.C3H5F3/c1-5-7-11(8-6-9-13)10-14-12(2,3)4;1-2-3(4,5)6/h9,11H,5-8,10H2,1-4H3;2H2,1H3 |
| InChIKey | DPEHMKDCASJBQN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane?
The IUPAC name of 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane (CID 176971137) is 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane.
What is the SMILES notation for 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane?
The canonical SMILES for 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane is CCC(F)(F)F.CCCC(CCC=O)COC(C)(C)C.
What is the InChIKey of 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane?
The InChIKey is DPEHMKDCASJBQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C3H5F3/c1-5-7-11(8-6-9-13)10-14-12(2,3)4;1-2-3(4,5)6/h9,11H,5-8,10H2,1-4H3;2H2,1H3.
What are the key properties of 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane?
4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane has a molecular weight of 298.39 g/mol, XLogP of 5.16, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methylpropan-2-yl)oxymethyl]heptanal;1,1,1-trifluoropropane is sourced from PubChem (CID 176971137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).