C24H26ClF2N5O4 — CID 176974719
7-chloro-4-[(2,4-dimethoxyphenyl)methylamino]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 176974719) has the molecular formula C24H26ClF2N5O4 and a molecular weight of 521.95 g/mol. Its IUPAC name is 7-chloro-4-[(2,4-dimethoxyphenyl)methylamino]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 7-chloro-4-[(2,4-dimethoxyphenyl)methylamino]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 176974719 |
| Molecular Formula | C24H26ClF2N5O4 |
| Molecular Weight | 521.95 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 7-chloro-4-[(2,4-dimethoxyphenyl)methylamino]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | COc1ccc(CNc2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(Cl)[nH]c(=O)c23)c(OC)c1 |
| InChI | InChI=1S/C24H26ClF2N5O4/c1-34-15-5-4-13(16(8-15)35-2)10-28-21-17-19(18(27)20(25)30-22(17)33)29-23(31-21)36-12-24-6-3-7-32(24)11-14(26)9-24/h4-5,8,14H,3,6-7,9-12H2,1-2H3,(H,30,33)(H,28,29,31)/t14-,24+/m1/s1 |
| InChIKey | WSZWSJQBJVQOBW-SHACYNPGSA-N |
| XLogP | 3.70 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.95 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|