C17H16ClFN4O4S — CID 176974569
7-chloro-4-[(2,4-dimethoxyphenyl)methylamino]-8-fluoro-2-methylsulfinyl-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 176974569) has the molecular formula C17H16ClFN4O4S and a molecular weight of 426.86 g/mol. Its IUPAC name is 7-chloro-4-[(2,4-dimethoxyphenyl)methylamino]-8-fluoro-2-methylsulfinyl-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 7-chloro-4-[(2,4-dimethoxyphenyl)methylamino]-8-fluoro-2-methylsulfinyl-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 176974569 |
| Molecular Formula | C17H16ClFN4O4S |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 7-chloro-4-[(2,4-dimethoxyphenyl)methylamino]-8-fluoro-2-methylsulfinyl-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | COc1ccc(CNc2nc(S(C)=O)nc3c(F)c(Cl)[nH]c(=O)c23)c(OC)c1 |
| InChI | InChI=1S/C17H16ClFN4O4S/c1-26-9-5-4-8(10(6-9)27-2)7-20-15-11-13(21-17(23-15)28(3)25)12(19)14(18)22-16(11)24/h4-6H,7H2,1-3H3,(H,22,24)(H,20,21,23) |
| InChIKey | XOKHSFMYAFYWFM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|