C25H41O7P — CID 176979484
benzyl 2-[bis[(2-methylpropan-2-yl)oxy]phosphanyloxymethyl]cyclopropane-1-carboxylate;tert-butyl formate (PubChem CID 176979484) has the molecular formula C25H41O7P and a molecular weight of 484.57 g/mol. Its IUPAC name is benzyl 2-[bis[(2-methylpropan-2-yl)oxy]phosphanyloxymethyl]cyclopropane-1-carboxylate;tert-butyl formate.
| Compound Name | benzyl 2-[bis[(2-methylpropan-2-yl)oxy]phosphanyloxymethyl]cyclopropane-1-carboxylate;tert-butyl formate |
|---|---|
| PubChem CID | 176979484 |
| Molecular Formula | C25H41O7P |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | benzyl 2-[bis[(2-methylpropan-2-yl)oxy]phosphanyloxymethyl]cyclopropane-1-carboxylate;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.CC(C)(C)OP(OCC1CC1C(=O)OCc1ccccc1)OC(C)(C)C |
| InChI | InChI=1S/C20H31O5P.C5H10O2/c1-19(2,3)24-26(25-20(4,5)6)23-14-16-12-17(16)18(21)22-13-15-10-8-7-9-11-15;1-5(2,3)7-4-6/h7-11,16-17H,12-14H2,1-6H3;4H,1-3H3 |
| InChIKey | AAGQQQOUGVIXMJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|