C12H31N5O2 — CID 176987325
N'-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethyl]ethane-1,2-diamine (PubChem CID 176987325) has the molecular formula C12H31N5O2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N'-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 176987325 |
| Molecular Formula | C12H31N5O2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N'-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCN(CCOCCN)CCOCCN |
| InChI | InChI=1S/C12H31N5O2/c13-1-4-16-5-6-17(7-11-18-9-2-14)8-12-19-10-3-15/h16H,1-15H2 |
| InChIKey | XJIPLIIXCANRSX-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|