C13H31N5O3 — CID 176987350
N-[2-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethylamino]ethyl]formamide (PubChem CID 176987350) has the molecular formula C13H31N5O3 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[2-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethylamino]ethyl]formamide.
| Compound Name | N-[2-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethylamino]ethyl]formamide |
|---|---|
| PubChem CID | 176987350 |
| Molecular Formula | C13H31N5O3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | N-[2-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethylamino]ethyl]formamide |
| SMILES | NCCOCCN(CCNCCNC=O)CCOCCN |
| InChI | InChI=1S/C13H31N5O3/c14-1-9-20-11-7-18(8-12-21-10-2-15)6-5-16-3-4-17-13-19/h13,16H,1-12,14-15H2,(H,17,19) |
| InChIKey | CZVKNWXCNNSQRT-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|