C13H30FmN5O3- — CID 176987349
[2-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethylamino]ethylamino]methanone;fermium (PubChem CID 176987349) has the molecular formula C13H30FmN5O3- and a molecular weight of 561.42 g/mol. Its IUPAC name is [2-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethylamino]ethylamino]methanone;fermium.
| Compound Name | [2-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethylamino]ethylamino]methanone;fermium |
|---|---|
| PubChem CID | 176987349 |
| Molecular Formula | C13H30FmN5O3- |
| Molecular Weight | 561.42 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | [2-[2-[bis[2-(2-aminoethoxy)ethyl]amino]ethylamino]ethylamino]methanone;fermium |
| SMILES | NCCOCCN(CCNCCN[C-]=O)CCOCCN.[Fm] |
| InChI | InChI=1S/C13H30N5O3.Fm/c14-1-9-20-11-7-18(8-12-21-10-2-15)6-5-16-3-4-17-13-19;/h16H,1-12,14-15H2,(H,17,19);/q-1; |
| InChIKey | FOSINMCXYJZXMB-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.42 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|