C22H23ClFFmN2O5S- — CID 176992920
tert-butyl 4-[[3-(4-chloro-2-fluorobenzoyl)-4,5-dimethylthiophen-2-yl]amino]-4-oxo-3-(oxomethylamino)butanoate;fermium (PubChem CID 176992920) has the molecular formula C22H23ClFFmN2O5S- and a molecular weight of 738.95 g/mol. Its IUPAC name is tert-butyl 4-[[3-(4-chloro-2-fluorobenzoyl)-4,5-dimethylthiophen-2-yl]amino]-4-oxo-3-(oxomethylamino)butanoate;fermium.
| Compound Name | tert-butyl 4-[[3-(4-chloro-2-fluorobenzoyl)-4,5-dimethylthiophen-2-yl]amino]-4-oxo-3-(oxomethylamino)butanoate;fermium |
|---|---|
| PubChem CID | 176992920 |
| Molecular Formula | C22H23ClFFmN2O5S- |
| Molecular Weight | 738.95 g/mol |
| Exact Mass | 738.20 |
| IUPAC Name | tert-butyl 4-[[3-(4-chloro-2-fluorobenzoyl)-4,5-dimethylthiophen-2-yl]amino]-4-oxo-3-(oxomethylamino)butanoate;fermium |
| SMILES | Cc1sc(NC(=O)C(CC(=O)OC(C)(C)C)N[C-]=O)c(C(=O)c2ccc(Cl)cc2F)c1C.[Fm] |
| InChI | InChI=1S/C22H23ClFN2O5S.Fm/c1-11-12(2)32-21(18(11)19(29)14-7-6-13(23)8-15(14)24)26-20(30)16(25-10-27)9-17(28)31-22(3,4)5;/h6-8,16H,9H2,1-5H3,(H,25,27)(H,26,30);/q-1; |
| InChIKey | GEAOVFNCQXSKMG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.95 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|