C21H25ClN2O4S — CID 176993014
tert-butyl 3-amino-4-[[3-(4-chlorobenzoyl)-4-ethylthiophen-2-yl]amino]-4-oxobutanoate (PubChem CID 176993014) has the molecular formula C21H25ClN2O4S and a molecular weight of 436.96 g/mol. Its IUPAC name is tert-butyl 3-amino-4-[[3-(4-chlorobenzoyl)-4-ethylthiophen-2-yl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl 3-amino-4-[[3-(4-chlorobenzoyl)-4-ethylthiophen-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 176993014 |
| Molecular Formula | C21H25ClN2O4S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | tert-butyl 3-amino-4-[[3-(4-chlorobenzoyl)-4-ethylthiophen-2-yl]amino]-4-oxobutanoate |
| SMILES | CCc1csc(NC(=O)C(N)CC(=O)OC(C)(C)C)c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O4S/c1-5-12-11-29-20(17(12)18(26)13-6-8-14(22)9-7-13)24-19(27)15(23)10-16(25)28-21(2,3)4/h6-9,11,15H,5,10,23H2,1-4H3,(H,24,27) |
| InChIKey | NLONXTNOGBEESE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |