C17H25N2O4S+ — CID 177002256
methyl 4-methyl-3-[[2-[1-(2-oxopropyl)piperidin-1-ium-1-yl]acetyl]amino]thiophene-2-carboxylate (PubChem CID 177002256) has the molecular formula C17H25N2O4S+ and a molecular weight of 353.46 g/mol. Its IUPAC name is methyl 4-methyl-3-[[2-[1-(2-oxopropyl)piperidin-1-ium-1-yl]acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[[2-[1-(2-oxopropyl)piperidin-1-ium-1-yl]acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 177002256 |
| Molecular Formula | C17H25N2O4S+ |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | methyl 4-methyl-3-[[2-[1-(2-oxopropyl)piperidin-1-ium-1-yl]acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)C[N+]1(CC(C)=O)CCCCC1 |
| InChI | InChI=1S/C17H24N2O4S/c1-12-11-24-16(17(22)23-3)15(12)18-14(21)10-19(9-13(2)20)7-5-4-6-8-19/h11H,4-10H2,1-3H3/p+1 |
| InChIKey | RLXUQUKUNLNVSE-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|