C27H44N3O5S+ — CID 177002124
N-(2-methoxyethyl)-N,4-dimethyl-3-[[2-[1-(2-oxopropyl)azepan-1-ium-1-yl]acetyl]amino]thiophene-2-carboxamide;(1Z)-1-methoxy-3-methylbuta-1,3-diene (PubChem CID 177002124) has the molecular formula C27H44N3O5S+ and a molecular weight of 522.73 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N,4-dimethyl-3-[[2-[1-(2-oxopropyl)azepan-1-ium-1-yl]acetyl]amino]thiophene-2-carboxamide;(1Z)-1-methoxy-3-methylbuta-1,3-diene.
| Compound Name | N-(2-methoxyethyl)-N,4-dimethyl-3-[[2-[1-(2-oxopropyl)azepan-1-ium-1-yl]acetyl]amino]thiophene-2-carboxamide;(1Z)-1-methoxy-3-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 177002124 |
| Molecular Formula | C27H44N3O5S+ |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | N-(2-methoxyethyl)-N,4-dimethyl-3-[[2-[1-(2-oxopropyl)azepan-1-ium-1-yl]acetyl]amino]thiophene-2-carboxamide;(1Z)-1-methoxy-3-methylbuta-1,3-diene |
| SMILES | C=C(C)/C=C\OC.COCCN(C)C(=O)c1scc(C)c1NC(=O)C[N+]1(CC(C)=O)CCCCCC1 |
| InChI | InChI=1S/C21H33N3O4S.C6H10O/c1-16-15-29-20(21(27)23(3)9-12-28-4)19(16)22-18(26)14-24(13-17(2)25)10-7-5-6-8-11-24;1-6(2)4-5-7-3/h15H,5-14H2,1-4H3;4-5H,1H2,2-3H3/p+1/b;5-4- |
| InChIKey | BWKRKJWLNYLTTQ-GUHKXDMSSA-O |
| XLogP | 4.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|