C27H31F3N4O2S — CID 177005639
N-[(2,4-dimethoxyphenyl)methyl]-N-[4-[3-[(dimethylamino)methyl]pyrrolidin-1-yl]-2,3-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine (PubChem CID 177005639) has the molecular formula C27H31F3N4O2S and a molecular weight of 532.63 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-N-[4-[3-[(dimethylamino)methyl]pyrrolidin-1-yl]-2,3-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-N-[4-[3-[(dimethylamino)methyl]pyrrolidin-1-yl]-2,3-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 177005639 |
| Molecular Formula | C27H31F3N4O2S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-N-[4-[3-[(dimethylamino)methyl]pyrrolidin-1-yl]-2,3-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
| SMILES | COc1ccc(CN(Sc2ccc(N3CCC(CN(C)C)C3)c(F)c2F)c2cccc(F)n2)c(OC)c1 |
| InChI | InChI=1S/C27H31F3N4O2S/c1-32(2)15-18-12-13-33(16-18)21-10-11-23(27(30)26(21)29)37-34(25-7-5-6-24(28)31-25)17-19-8-9-20(35-3)14-22(19)36-4/h5-11,14,18H,12-13,15-17H2,1-4H3 |
| InChIKey | YOPYYJKZVHFQLQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|