C27H25Cl2F2N3O4S — CID 178026262
2-[2,5-dichloro-4-[(2,4-dimethoxyphenyl)methyl-(6-fluoro-2-pyridinyl)amino]sulfanyl-3-fluorophenyl]-5-oxa-2-azaspiro[3.5]nonan-8-one (PubChem CID 178026262) has the molecular formula C27H25Cl2F2N3O4S and a molecular weight of 596.48 g/mol. Its IUPAC name is 2-[2,5-dichloro-4-[(2,4-dimethoxyphenyl)methyl-(6-fluoro-2-pyridinyl)amino]sulfanyl-3-fluorophenyl]-5-oxa-2-azaspiro[3.5]nonan-8-one.
| Compound Name | 2-[2,5-dichloro-4-[(2,4-dimethoxyphenyl)methyl-(6-fluoro-2-pyridinyl)amino]sulfanyl-3-fluorophenyl]-5-oxa-2-azaspiro[3.5]nonan-8-one |
|---|---|
| PubChem CID | 178026262 |
| Molecular Formula | C27H25Cl2F2N3O4S |
| Molecular Weight | 596.48 g/mol |
| Exact Mass | 595.09 |
| IUPAC Name | 2-[2,5-dichloro-4-[(2,4-dimethoxyphenyl)methyl-(6-fluoro-2-pyridinyl)amino]sulfanyl-3-fluorophenyl]-5-oxa-2-azaspiro[3.5]nonan-8-one |
| SMILES | COc1ccc(CN(Sc2c(Cl)cc(N3CC4(CC(=O)CCO4)C3)c(Cl)c2F)c2cccc(F)n2)c(OC)c1 |
| InChI | InChI=1S/C27H25Cl2F2N3O4S/c1-36-18-7-6-16(21(10-18)37-2)13-34(23-5-3-4-22(30)32-23)39-26-19(28)11-20(24(29)25(26)31)33-14-27(15-33)12-17(35)8-9-38-27/h3-7,10-11H,8-9,12-15H2,1-2H3 |
| InChIKey | JMGYKAIFKYNKPD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|