C22H25Cl2F3N4OS — CID 178026439
N-[3,6-dichloro-2-fluoro-4-[3-[2-(4-fluoropiperidin-1-yl)ethyl]-3-methoxyazetidin-1-yl]phenyl]sulfanyl-6-fluoropyridin-2-amine (PubChem CID 178026439) has the molecular formula C22H25Cl2F3N4OS and a molecular weight of 521.44 g/mol. Its IUPAC name is N-[3,6-dichloro-2-fluoro-4-[3-[2-(4-fluoropiperidin-1-yl)ethyl]-3-methoxyazetidin-1-yl]phenyl]sulfanyl-6-fluoropyridin-2-amine.
| Compound Name | N-[3,6-dichloro-2-fluoro-4-[3-[2-(4-fluoropiperidin-1-yl)ethyl]-3-methoxyazetidin-1-yl]phenyl]sulfanyl-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 178026439 |
| Molecular Formula | C22H25Cl2F3N4OS |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | N-[3,6-dichloro-2-fluoro-4-[3-[2-(4-fluoropiperidin-1-yl)ethyl]-3-methoxyazetidin-1-yl]phenyl]sulfanyl-6-fluoropyridin-2-amine |
| SMILES | COC1(CCN2CCC(F)CC2)CN(c2cc(Cl)c(SNc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C22H25Cl2F3N4OS/c1-32-22(7-10-30-8-5-14(25)6-9-30)12-31(13-22)16-11-15(23)21(20(27)19(16)24)33-29-18-4-2-3-17(26)28-18/h2-4,11,14H,5-10,12-13H2,1H3,(H,28,29) |
| InChIKey | PFTLSMSFWJGTFD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|