C21H24ClF3N4O2S — CID 178026394
3-chloro-4-[3-cyclopropyl-3-[2-(dimethylamino)ethyl]azetidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 178026394) has the molecular formula C21H24ClF3N4O2S and a molecular weight of 488.96 g/mol. Its IUPAC name is 3-chloro-4-[3-cyclopropyl-3-[2-(dimethylamino)ethyl]azetidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-[3-cyclopropyl-3-[2-(dimethylamino)ethyl]azetidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 178026394 |
| Molecular Formula | C21H24ClF3N4O2S |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 3-chloro-4-[3-cyclopropyl-3-[2-(dimethylamino)ethyl]azetidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CN(C)CCC1(C2CC2)CN(c2cc(F)c(S(=O)(=O)Nc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C21H24ClF3N4O2S/c1-28(2)9-8-21(13-6-7-13)11-29(12-21)15-10-14(23)20(19(25)18(15)22)32(30,31)27-17-5-3-4-16(24)26-17/h3-5,10,13H,6-9,11-12H2,1-2H3,(H,26,27) |
| InChIKey | GOQFNRUFCMYGES-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|