C19H19ClF3N5O2S — CID 177005598
3-chloro-4-[(3R)-3-cyano-3-[(dimethylamino)methyl]pyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 177005598) has the molecular formula C19H19ClF3N5O2S and a molecular weight of 473.91 g/mol. Its IUPAC name is 3-chloro-4-[(3R)-3-cyano-3-[(dimethylamino)methyl]pyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-[(3R)-3-cyano-3-[(dimethylamino)methyl]pyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177005598 |
| Molecular Formula | C19H19ClF3N5O2S |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 3-chloro-4-[(3R)-3-cyano-3-[(dimethylamino)methyl]pyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CN(C)C[C@]1(C#N)CCN(c2cc(F)c(S(=O)(=O)Nc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C19H19ClF3N5O2S/c1-27(2)10-19(9-24)6-7-28(11-19)13-8-12(21)18(17(23)16(13)20)31(29,30)26-15-5-3-4-14(22)25-15/h3-5,8H,6-7,10-11H2,1-2H3,(H,25,26)/t19-/m1/s1 |
| InChIKey | YAUJGNBIPSQXHT-LJQANCHMSA-N |
| XLogP | 3.23 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|