C19H20ClF3N4O2S — CID 177005628
3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)-4-[(5R)-1-methyl-1,7-diazaspiro[4.4]nonan-7-yl]benzenesulfonamide (PubChem CID 177005628) has the molecular formula C19H20ClF3N4O2S and a molecular weight of 460.91 g/mol. Its IUPAC name is 3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)-4-[(5R)-1-methyl-1,7-diazaspiro[4.4]nonan-7-yl]benzenesulfonamide.
| Compound Name | 3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)-4-[(5R)-1-methyl-1,7-diazaspiro[4.4]nonan-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177005628 |
| Molecular Formula | C19H20ClF3N4O2S |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)-4-[(5R)-1-methyl-1,7-diazaspiro[4.4]nonan-7-yl]benzenesulfonamide |
| SMILES | CN1CCC[C@]12CCN(c1cc(F)c(S(=O)(=O)Nc3cccc(F)n3)c(F)c1Cl)C2 |
| InChI | InChI=1S/C19H20ClF3N4O2S/c1-26-8-3-6-19(26)7-9-27(11-19)13-10-12(21)18(17(23)16(13)20)30(28,29)25-15-5-2-4-14(22)24-15/h2,4-5,10H,3,6-9,11H2,1H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | FGAYCYYGRCRLLP-LJQANCHMSA-N |
| XLogP | 3.63 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|