C23H24ClF3N4O2S — CID 177005965
4-[(3R,4S)-3-(2-azabicyclo[2.1.1]hexan-2-yl)-6-azaspiro[3.4]octan-6-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 177005965) has the molecular formula C23H24ClF3N4O2S and a molecular weight of 512.99 g/mol. Its IUPAC name is 4-[(3R,4S)-3-(2-azabicyclo[2.1.1]hexan-2-yl)-6-azaspiro[3.4]octan-6-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-[(3R,4S)-3-(2-azabicyclo[2.1.1]hexan-2-yl)-6-azaspiro[3.4]octan-6-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177005965 |
| Molecular Formula | C23H24ClF3N4O2S |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 4-[(3R,4S)-3-(2-azabicyclo[2.1.1]hexan-2-yl)-6-azaspiro[3.4]octan-6-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(F)n1)c1c(F)cc(N2CC[C@@]3(CC[C@H]3N3CC4CC3C4)C2)c(Cl)c1F |
| InChI | InChI=1S/C23H24ClF3N4O2S/c24-20-16(30-7-6-23(12-30)5-4-17(23)31-11-13-8-14(31)9-13)10-15(25)22(21(20)27)34(32,33)29-19-3-1-2-18(26)28-19/h1-3,10,13-14,17H,4-9,11-12H2,(H,28,29)/t13?,14?,17-,23+/m1/s1 |
| InChIKey | QCJDGIUICSOBFK-UZRZOHQUSA-N |
| XLogP | 4.41 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|