C20H22ClF3N4O2S — CID 177005875
3-chloro-4-[(3S,4R)-3-(dimethylamino)-6-azaspiro[3.4]octan-6-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 177005875) has the molecular formula C20H22ClF3N4O2S and a molecular weight of 474.94 g/mol. Its IUPAC name is 3-chloro-4-[(3S,4R)-3-(dimethylamino)-6-azaspiro[3.4]octan-6-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-[(3S,4R)-3-(dimethylamino)-6-azaspiro[3.4]octan-6-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177005875 |
| Molecular Formula | C20H22ClF3N4O2S |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 3-chloro-4-[(3S,4R)-3-(dimethylamino)-6-azaspiro[3.4]octan-6-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CN(C)[C@H]1CC[C@]12CCN(c1cc(F)c(S(=O)(=O)Nc3cccc(F)n3)c(F)c1Cl)C2 |
| InChI | InChI=1S/C20H22ClF3N4O2S/c1-27(2)14-6-7-20(14)8-9-28(11-20)13-10-12(22)19(18(24)17(13)21)31(29,30)26-16-5-3-4-15(23)25-16/h3-5,10,14H,6-9,11H2,1-2H3,(H,25,26)/t14-,20+/m0/s1 |
| InChIKey | JNBLVNUUNKIEEH-VBKZILBWSA-N |
| XLogP | 3.87 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|