C22H28ClF3N4O3S — CID 177005664
4-[(3R)-3-[[tert-butyl(methyl)amino]methyl]-3-methoxypyrrolidin-1-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 177005664) has the molecular formula C22H28ClF3N4O3S and a molecular weight of 521.01 g/mol. Its IUPAC name is 4-[(3R)-3-[[tert-butyl(methyl)amino]methyl]-3-methoxypyrrolidin-1-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-[(3R)-3-[[tert-butyl(methyl)amino]methyl]-3-methoxypyrrolidin-1-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177005664 |
| Molecular Formula | C22H28ClF3N4O3S |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 4-[(3R)-3-[[tert-butyl(methyl)amino]methyl]-3-methoxypyrrolidin-1-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CO[C@@]1(CN(C)C(C)(C)C)CCN(c2cc(F)c(S(=O)(=O)Nc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C22H28ClF3N4O3S/c1-21(2,3)29(4)12-22(33-5)9-10-30(13-22)15-11-14(24)20(19(26)18(15)23)34(31,32)28-17-8-6-7-16(25)27-17/h6-8,11H,9-10,12-13H2,1-5H3,(H,27,28)/t22-/m1/s1 |
| InChIKey | PSSQKEIDMBVWET-JOCHJYFZSA-N |
| XLogP | 4.28 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|