C20H24ClF3N4O3S — CID 177005622
3-chloro-4-[(2S,4R)-4-[(dimethylamino)methyl]-4-methoxy-2-methylpyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 177005622) has the molecular formula C20H24ClF3N4O3S and a molecular weight of 492.95 g/mol. Its IUPAC name is 3-chloro-4-[(2S,4R)-4-[(dimethylamino)methyl]-4-methoxy-2-methylpyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-[(2S,4R)-4-[(dimethylamino)methyl]-4-methoxy-2-methylpyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177005622 |
| Molecular Formula | C20H24ClF3N4O3S |
| Molecular Weight | 492.95 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 3-chloro-4-[(2S,4R)-4-[(dimethylamino)methyl]-4-methoxy-2-methylpyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CO[C@@]1(CN(C)C)C[C@H](C)N(c2cc(F)c(S(=O)(=O)Nc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C20H24ClF3N4O3S/c1-12-9-20(31-4,10-27(2)3)11-28(12)14-8-13(22)19(18(24)17(14)21)32(29,30)26-16-7-5-6-15(23)25-16/h5-8,12H,9-11H2,1-4H3,(H,25,26)/t12-,20+/m0/s1 |
| InChIKey | RZIOKRGNHLWJQV-FKIZINRSSA-N |
| XLogP | 3.50 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.95 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|