C18H20ClF3N4O2S — CID 177006349
3-chloro-4-[(2S,4R)-4-(dimethylamino)-2-methylpyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 177006349) has the molecular formula C18H20ClF3N4O2S and a molecular weight of 448.90 g/mol. Its IUPAC name is 3-chloro-4-[(2S,4R)-4-(dimethylamino)-2-methylpyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-[(2S,4R)-4-(dimethylamino)-2-methylpyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177006349 |
| Molecular Formula | C18H20ClF3N4O2S |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-chloro-4-[(2S,4R)-4-(dimethylamino)-2-methylpyrrolidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | C[C@H]1C[C@@H](N(C)C)CN1c1cc(F)c(S(=O)(=O)Nc2cccc(F)n2)c(F)c1Cl |
| InChI | InChI=1S/C18H20ClF3N4O2S/c1-10-7-11(25(2)3)9-26(10)13-8-12(20)18(17(22)16(13)19)29(27,28)24-15-6-4-5-14(21)23-15/h4-6,8,10-11H,7,9H2,1-3H3,(H,23,24)/t10-,11+/m0/s1 |
| InChIKey | MOLMQCMYPDTMRZ-WDEREUQCSA-N |
| XLogP | 3.48 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|