C19H22ClF3N4O2S — CID 178026247
3-chloro-4-[3-[2-(dimethylamino)ethyl]-3-methylazetidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 178026247) has the molecular formula C19H22ClF3N4O2S and a molecular weight of 462.93 g/mol. Its IUPAC name is 3-chloro-4-[3-[2-(dimethylamino)ethyl]-3-methylazetidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-[3-[2-(dimethylamino)ethyl]-3-methylazetidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 178026247 |
| Molecular Formula | C19H22ClF3N4O2S |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 3-chloro-4-[3-[2-(dimethylamino)ethyl]-3-methylazetidin-1-yl]-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CN(C)CCC1(C)CN(c2cc(F)c(S(=O)(=O)Nc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C19H22ClF3N4O2S/c1-19(7-8-26(2)3)10-27(11-19)13-9-12(21)18(17(23)16(13)20)30(28,29)25-15-6-4-5-14(22)24-15/h4-6,9H,7-8,10-11H2,1-3H3,(H,24,25) |
| InChIKey | RXBGQOUYSMGCML-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|