C20H24ClF3N4O2S — CID 177005973
4-[3-(3-amino-3-methylbutyl)pyrrolidin-1-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 177005973) has the molecular formula C20H24ClF3N4O2S and a molecular weight of 476.95 g/mol. Its IUPAC name is 4-[3-(3-amino-3-methylbutyl)pyrrolidin-1-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-[3-(3-amino-3-methylbutyl)pyrrolidin-1-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177005973 |
| Molecular Formula | C20H24ClF3N4O2S |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 4-[3-(3-amino-3-methylbutyl)pyrrolidin-1-yl]-3-chloro-2,6-difluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CC(C)(N)CCC1CCN(c2cc(F)c(S(=O)(=O)Nc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C20H24ClF3N4O2S/c1-20(2,25)8-6-12-7-9-28(11-12)14-10-13(22)19(18(24)17(14)21)31(29,30)27-16-5-3-4-15(23)26-16/h3-5,10,12H,6-9,11,25H2,1-2H3,(H,26,27) |
| InChIKey | ZXJPIOCFVXJCDM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|