C23H26ClF3N4S — CID 177005589
N-[4-[3-(5-azaspiro[3.4]octan-5-yl)-3-methylpyrrolidin-1-yl]-3-chloro-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine (PubChem CID 177005589) has the molecular formula C23H26ClF3N4S and a molecular weight of 483.00 g/mol. Its IUPAC name is N-[4-[3-(5-azaspiro[3.4]octan-5-yl)-3-methylpyrrolidin-1-yl]-3-chloro-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine.
| Compound Name | N-[4-[3-(5-azaspiro[3.4]octan-5-yl)-3-methylpyrrolidin-1-yl]-3-chloro-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 177005589 |
| Molecular Formula | C23H26ClF3N4S |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-[4-[3-(5-azaspiro[3.4]octan-5-yl)-3-methylpyrrolidin-1-yl]-3-chloro-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
| SMILES | CC1(N2CCCC23CCC3)CCN(c2cc(F)c(SNc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C23H26ClF3N4S/c1-22(31-11-4-9-23(31)7-3-8-23)10-12-30(14-22)16-13-15(25)21(20(27)19(16)24)32-29-18-6-2-5-17(26)28-18/h2,5-6,13H,3-4,7-12,14H2,1H3,(H,28,29) |
| InChIKey | ROURAVDCPCZCEH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|