C14H11Cl2F2N3S — CID 178026399
N-[4-(azetidin-1-yl)-3,6-dichloro-2-fluorophenyl]sulfanyl-6-fluoropyridin-2-amine (PubChem CID 178026399) has the molecular formula C14H11Cl2F2N3S and a molecular weight of 362.23 g/mol. Its IUPAC name is N-[4-(azetidin-1-yl)-3,6-dichloro-2-fluorophenyl]sulfanyl-6-fluoropyridin-2-amine.
| Compound Name | N-[4-(azetidin-1-yl)-3,6-dichloro-2-fluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 178026399 |
| Molecular Formula | C14H11Cl2F2N3S |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | N-[4-(azetidin-1-yl)-3,6-dichloro-2-fluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
| SMILES | Fc1cccc(NSc2c(Cl)cc(N3CCC3)c(Cl)c2F)n1 |
| InChI | InChI=1S/C14H11Cl2F2N3S/c15-8-7-9(21-5-2-6-21)12(16)13(18)14(8)22-20-11-4-1-3-10(17)19-11/h1,3-4,7H,2,5-6H2,(H,19,20) |
| InChIKey | SACABHNYBFCWBC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|