C24H32ClF3N4S — CID 177006139
N-[4-[3-[4-(butylamino)butyl]-3-methylpyrrolidin-1-yl]-3-chloro-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine (PubChem CID 177006139) has the molecular formula C24H32ClF3N4S and a molecular weight of 501.06 g/mol. Its IUPAC name is N-[4-[3-[4-(butylamino)butyl]-3-methylpyrrolidin-1-yl]-3-chloro-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine.
| Compound Name | N-[4-[3-[4-(butylamino)butyl]-3-methylpyrrolidin-1-yl]-3-chloro-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 177006139 |
| Molecular Formula | C24H32ClF3N4S |
| Molecular Weight | 501.06 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N-[4-[3-[4-(butylamino)butyl]-3-methylpyrrolidin-1-yl]-3-chloro-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
| SMILES | CCCCNCCCCC1(C)CCN(c2cc(F)c(SNc3cccc(F)n3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C24H32ClF3N4S/c1-3-4-12-29-13-6-5-10-24(2)11-14-32(16-24)18-15-17(26)23(22(28)21(18)25)33-31-20-9-7-8-19(27)30-20/h7-9,15,29H,3-6,10-14,16H2,1-2H3,(H,30,31) |
| InChIKey | AGUYISXKEOHQJJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.06 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|