C16H19ClF2N4S2 — CID 177005647
N-[3-chloro-4-[3-(dimethylamino)-3-methylpyrrolidin-1-yl]-2,6-difluorophenyl]sulfanyl-1,3-thiazol-2-amine (PubChem CID 177005647) has the molecular formula C16H19ClF2N4S2 and a molecular weight of 404.94 g/mol. Its IUPAC name is N-[3-chloro-4-[3-(dimethylamino)-3-methylpyrrolidin-1-yl]-2,6-difluorophenyl]sulfanyl-1,3-thiazol-2-amine.
| Compound Name | N-[3-chloro-4-[3-(dimethylamino)-3-methylpyrrolidin-1-yl]-2,6-difluorophenyl]sulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 177005647 |
| Molecular Formula | C16H19ClF2N4S2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-[3-chloro-4-[3-(dimethylamino)-3-methylpyrrolidin-1-yl]-2,6-difluorophenyl]sulfanyl-1,3-thiazol-2-amine |
| SMILES | CN(C)C1(C)CCN(c2cc(F)c(SNc3nccs3)c(F)c2Cl)C1 |
| InChI | InChI=1S/C16H19ClF2N4S2/c1-16(22(2)3)4-6-23(9-16)11-8-10(18)14(13(19)12(11)17)25-21-15-20-5-7-24-15/h5,7-8H,4,6,9H2,1-3H3,(H,20,21) |
| InChIKey | ZCIBQEFLMUAABO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|