C28H30ClF3N4O2S — CID 178026259
N-[3-chloro-2,6-difluoro-4-[3-(1-methylpyrrolidin-2-yl)azetidin-1-yl]phenyl]sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-6-fluoropyridin-2-amine (PubChem CID 178026259) has the molecular formula C28H30ClF3N4O2S and a molecular weight of 579.09 g/mol. Its IUPAC name is N-[3-chloro-2,6-difluoro-4-[3-(1-methylpyrrolidin-2-yl)azetidin-1-yl]phenyl]sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-6-fluoropyridin-2-amine.
| Compound Name | N-[3-chloro-2,6-difluoro-4-[3-(1-methylpyrrolidin-2-yl)azetidin-1-yl]phenyl]sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 178026259 |
| Molecular Formula | C28H30ClF3N4O2S |
| Molecular Weight | 579.09 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | N-[3-chloro-2,6-difluoro-4-[3-(1-methylpyrrolidin-2-yl)azetidin-1-yl]phenyl]sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-6-fluoropyridin-2-amine |
| SMILES | COc1ccc(CN(Sc2c(F)cc(N3CC(C4CCCN4C)C3)c(Cl)c2F)c2cccc(F)n2)c(OC)c1 |
| InChI | InChI=1S/C28H30ClF3N4O2S/c1-34-11-5-6-21(34)18-14-35(15-18)22-13-20(30)28(27(32)26(22)29)39-36(25-8-4-7-24(31)33-25)16-17-9-10-19(37-2)12-23(17)38-3/h4,7-10,12-13,18,21H,5-6,11,14-16H2,1-3H3 |
| InChIKey | MOXFORMRBHEKAZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.09 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|