C20H17F3N2O4S — CID 177008846
2-[[2-(trifluoromethylsulfonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]benzoic acid (PubChem CID 177008846) has the molecular formula C20H17F3N2O4S and a molecular weight of 438.43 g/mol. Its IUPAC name is 2-[[2-(trifluoromethylsulfonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]benzoic acid.
| Compound Name | 2-[[2-(trifluoromethylsulfonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 177008846 |
| Molecular Formula | C20H17F3N2O4S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[[2-(trifluoromethylsulfonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1Cn1c2c(c3ccccc31)CN(S(=O)(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C20H17F3N2O4S/c21-20(22,23)30(28,29)24-10-9-18-16(12-24)15-7-3-4-8-17(15)25(18)11-13-5-1-2-6-14(13)19(26)27/h1-8H,9-12H2,(H,26,27) |
| InChIKey | OTMMNISFNOOFJE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|