C43H40N2O9 — CID 177008886
9-[(2-carboxy-6-methoxyphenyl)methyl]-5,6,7,8-tetrahydrocarbazole-2-carboxylic acid;9-[(2-carboxyphenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 177008886) has the molecular formula C43H40N2O9 and a molecular weight of 728.80 g/mol. Its IUPAC name is 9-[(2-carboxy-6-methoxyphenyl)methyl]-5,6,7,8-tetrahydrocarbazole-2-carboxylic acid;9-[(2-carboxyphenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-[(2-carboxy-6-methoxyphenyl)methyl]-5,6,7,8-tetrahydrocarbazole-2-carboxylic acid;9-[(2-carboxyphenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 177008886 |
| Molecular Formula | C43H40N2O9 |
| Molecular Weight | 728.80 g/mol |
| Exact Mass | 728.27 |
| IUPAC Name | 9-[(2-carboxy-6-methoxyphenyl)methyl]-5,6,7,8-tetrahydrocarbazole-2-carboxylic acid;9-[(2-carboxyphenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | COc1cccc(C(=O)O)c1Cn1c2c(c3ccc(C(=O)O)cc31)CCCC2.O=C(O)c1ccccc1Cn1c2c(c3ccccc31)CC(C(=O)O)CC2 |
| InChI | InChI=1S/C22H21NO5.C21H19NO4/c1-28-20-8-4-6-16(22(26)27)17(20)12-23-18-7-3-2-5-14(18)15-10-9-13(21(24)25)11-19(15)23;23-20(24)13-9-10-19-17(11-13)16-7-3-4-8-18(16)22(19)12-14-5-1-2-6-15(14)21(25)26/h4,6,8-11H,2-3,5,7,12H2,1H3,(H,24,25)(H,26,27);1-8,13H,9-12H2,(H,23,24)(H,25,26) |
| InChIKey | JLMKKAAYCGJTBE-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 168.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.80 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|