C48H94N2O8 — CID 177026657
[15-(4,4-dipentoxybutanoyloxy)-8-[(1-methylpiperidin-4-yl)amino]pentadecyl] 4-butoxy-4-pentoxybutanoate (PubChem CID 177026657) has the molecular formula C48H94N2O8 and a molecular weight of 827.29 g/mol. Its IUPAC name is [15-(4,4-dipentoxybutanoyloxy)-8-[(1-methylpiperidin-4-yl)amino]pentadecyl] 4-butoxy-4-pentoxybutanoate.
| Compound Name | [15-(4,4-dipentoxybutanoyloxy)-8-[(1-methylpiperidin-4-yl)amino]pentadecyl] 4-butoxy-4-pentoxybutanoate |
|---|---|
| PubChem CID | 177026657 |
| Molecular Formula | C48H94N2O8 |
| Molecular Weight | 827.29 g/mol |
| Exact Mass | 826.70 |
| IUPAC Name | [15-(4,4-dipentoxybutanoyloxy)-8-[(1-methylpiperidin-4-yl)amino]pentadecyl] 4-butoxy-4-pentoxybutanoate |
| SMILES | CCCCCOC(CCC(=O)OCCCCCCCC(CCCCCCCOC(=O)CCC(OCCCCC)OCCCCC)NC1CCN(C)CC1)OCCCC |
| InChI | InChI=1S/C48H94N2O8/c1-6-10-22-40-56-47(55-37-13-9-4)31-29-45(51)53-38-25-18-14-16-20-27-43(49-44-33-35-50(5)36-34-44)28-21-17-15-19-26-39-54-46(52)30-32-48(57-41-23-11-7-2)58-42-24-12-8-3/h43-44,47-49H,6-42H2,1-5H3 |
| InChIKey | HEVAIBHONQUYIO-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.29 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|