C57H110N2O10 — CID 177026679
[15-(4,4-dipentoxybutanoyloxy)-8-[heptoxycarbonyl-(1-methylpiperidin-4-yl)amino]pentadecyl] 4,4-dipentoxybutanoate (PubChem CID 177026679) has the molecular formula C57H110N2O10 and a molecular weight of 983.51 g/mol. Its IUPAC name is [15-(4,4-dipentoxybutanoyloxy)-8-[heptoxycarbonyl-(1-methylpiperidin-4-yl)amino]pentadecyl] 4,4-dipentoxybutanoate.
| Compound Name | [15-(4,4-dipentoxybutanoyloxy)-8-[heptoxycarbonyl-(1-methylpiperidin-4-yl)amino]pentadecyl] 4,4-dipentoxybutanoate |
|---|---|
| PubChem CID | 177026679 |
| Molecular Formula | C57H110N2O10 |
| Molecular Weight | 983.51 g/mol |
| Exact Mass | 982.82 |
| IUPAC Name | [15-(4,4-dipentoxybutanoyloxy)-8-[heptoxycarbonyl-(1-methylpiperidin-4-yl)amino]pentadecyl] 4,4-dipentoxybutanoate |
| SMILES | CCCCCCCOC(=O)N(C(CCCCCCCOC(=O)CCC(OCCCCC)OCCCCC)CCCCCCCOC(=O)CCC(OCCCCC)OCCCCC)C1CCN(C)CC1 |
| InChI | InChI=1S/C57H110N2O10/c1-7-12-17-22-33-50-69-57(62)59(52-40-42-58(6)43-41-52)51(34-25-20-18-23-31-44-63-53(60)36-38-55(65-46-27-13-8-2)66-47-28-14-9-3)35-26-21-19-24-32-45-64-54(61)37-39-56(67-48-29-15-10-4)68-49-30-16-11-5/h51-52,55-56H,7-50H2,1-6H3 |
| InChIKey | VLOIPPJSSKEIPJ-UHFFFAOYSA-N |
| XLogP | 14.67 |
| TPSA | 122.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.51 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|