C13H17F2NO — CID 177029806
N-(2,4-difluoro-3-propan-2-ylphenyl)butanamide (PubChem CID 177029806) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is N-(2,4-difluoro-3-propan-2-ylphenyl)butanamide.
| Compound Name | N-(2,4-difluoro-3-propan-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 177029806 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-(2,4-difluoro-3-propan-2-ylphenyl)butanamide |
| SMILES | CCCC(=O)Nc1ccc(F)c(C(C)C)c1F |
| InChI | InChI=1S/C13H17F2NO/c1-4-5-11(17)16-10-7-6-9(14)12(8(2)3)13(10)15/h6-8H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | SMXVXMIONWZTEH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |