C19H23N3O3 — CID 177031510
benzyl 2-(4-aminopent-1-en-2-ylamino)-4-methoxypyridine-3-carboxylate (PubChem CID 177031510) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is benzyl 2-(4-aminopent-1-en-2-ylamino)-4-methoxypyridine-3-carboxylate.
| Compound Name | benzyl 2-(4-aminopent-1-en-2-ylamino)-4-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 177031510 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | benzyl 2-(4-aminopent-1-en-2-ylamino)-4-methoxypyridine-3-carboxylate |
| SMILES | C=C(CC(C)N)Nc1nccc(OC)c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H23N3O3/c1-13(20)11-14(2)22-18-17(16(24-3)9-10-21-18)19(23)25-12-15-7-5-4-6-8-15/h4-10,13H,2,11-12,20H2,1,3H3,(H,21,22) |
| InChIKey | JDRIYAHSCOTDCZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |