C29H29F2N5O2 — CID 177047594
1-[3-[[[[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]amino]-hydroxymethyl]amino]methyl]piperidin-1-yl]ethanone (PubChem CID 177047594) has the molecular formula C29H29F2N5O2 and a molecular weight of 517.58 g/mol. Its IUPAC name is 1-[3-[[[[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]amino]-hydroxymethyl]amino]methyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-[[[[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]amino]-hydroxymethyl]amino]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 177047594 |
| Molecular Formula | C29H29F2N5O2 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 1-[3-[[[[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]amino]-hydroxymethyl]amino]methyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(CNC(O)Nc2ccc3nc(-c4ccc(F)cc4)c(-c4ccc(F)cc4)nc3c2)C1 |
| InChI | InChI=1S/C29H29F2N5O2/c1-18(37)36-14-2-3-19(17-36)16-32-29(38)33-24-12-13-25-26(15-24)35-28(21-6-10-23(31)11-7-21)27(34-25)20-4-8-22(30)9-5-20/h4-13,15,19,29,32-33,38H,2-3,14,16-17H2,1H3 |
| InChIKey | BOOKFQREJLYSID-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|