C16H28N4 — CID 177049818
ethane;N-[(1Z,3E)-3-(1-ethyl-5-propan-2-yl-1,2,4-triazol-3-yl)penta-1,3-dienyl]ethanimine (PubChem CID 177049818) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is ethane;N-[(1Z,3E)-3-(1-ethyl-5-propan-2-yl-1,2,4-triazol-3-yl)penta-1,3-dienyl]ethanimine.
| Compound Name | ethane;N-[(1Z,3E)-3-(1-ethyl-5-propan-2-yl-1,2,4-triazol-3-yl)penta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 177049818 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | ethane;N-[(1Z,3E)-3-(1-ethyl-5-propan-2-yl-1,2,4-triazol-3-yl)penta-1,3-dienyl]ethanimine |
| SMILES | C/C=N/C=C\C(=C/C)c1nc(C(C)C)n(CC)n1.CC |
| InChI | InChI=1S/C14H22N4.C2H6/c1-6-12(9-10-15-7-2)13-16-14(11(4)5)18(8-3)17-13;1-2/h6-7,9-11H,8H2,1-5H3;1-2H3/b10-9-,12-6+,15-7+; |
| InChIKey | OGOWKOZXDFPQSL-MESUQOAVSA-N |
| XLogP | 4.46 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|