C21H34N4 — CID 143333574
ethane;4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-[(3E)-hexa-1,3,5-trien-3-yl]-N,N-dimethyl-1,2,4-triazol-3-amine (PubChem CID 143333574) has the molecular formula C21H34N4 and a molecular weight of 342.53 g/mol. Its IUPAC name is ethane;4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-[(3E)-hexa-1,3,5-trien-3-yl]-N,N-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-[(3E)-hexa-1,3,5-trien-3-yl]-N,N-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 143333574 |
| Molecular Formula | C21H34N4 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-[(3E)-hexa-1,3,5-trien-3-yl]-N,N-dimethyl-1,2,4-triazol-3-amine |
| SMILES | C=C/C=C(\C=C)c1nnc(N(C)C)n1/C(C=C)=C/C=C\C.CC.CC |
| InChI | InChI=1S/C17H22N4.2C2H6/c1-7-11-13-15(10-4)21-16(14(9-3)12-8-2)18-19-17(21)20(5)6;2*1-2/h7-13H,2-4H2,1,5-6H3;2*1-2H3/b11-7-,14-12+,15-13+;; |
| InChIKey | WRCXILRMFNLITL-KAYDMGDESA-N |
| XLogP | 5.75 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|