C14H23N3 — CID 144869900
ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-propan-2-yl-1,2,4-triazole (PubChem CID 144869900) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-propan-2-yl-1,2,4-triazole.
| Compound Name | ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 144869900 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-propan-2-yl-1,2,4-triazole |
| SMILES | C=C/C=C(\C=C)Cn1cnc(C(C)C)n1.CC |
| InChI | InChI=1S/C12H17N3.C2H6/c1-5-7-11(6-2)8-15-9-13-12(14-15)10(3)4;1-2/h5-7,9-10H,1-2,8H2,3-4H3;1-2H3/b11-7+; |
| InChIKey | HRSVEKAZHAWJRH-RVDQCCQOSA-N |
| XLogP | 3.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|