C13H19N — CID 177055081
(2Z,4E)-2-[(E)-pent-1-enyl]octa-2,4,7-trien-1-imine (PubChem CID 177055081) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (2Z,4E)-2-[(E)-pent-1-enyl]octa-2,4,7-trien-1-imine.
| Compound Name | (2Z,4E)-2-[(E)-pent-1-enyl]octa-2,4,7-trien-1-imine |
|---|---|
| PubChem CID | 177055081 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (2Z,4E)-2-[(E)-pent-1-enyl]octa-2,4,7-trien-1-imine |
| SMILES | [H]/N=C/C(=C\C=C\CC=C)/C=C/CCC |
| InChI | InChI=1S/C13H19N/c1-3-5-7-9-11-13(12-14)10-8-6-4-2/h3,7-12,14H,1,4-6H2,2H3/b9-7+,10-8+,13-11-,14-12+ |
| InChIKey | MXAVCNRCKMORCH-XYWFYHDDSA-N |
| XLogP | 4.05 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|